About 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid
3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid (PubChem CID 79619645) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid |
| PubChem CID | 79619645 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid |
| SMILES | CN(CC(C)(C)C(=O)O)C1CC2CCC(C1)N2 |
| InChI | InChI=1S/C13H24N2O2/c1-13(2,12(16)17)8-15(3)11-6-9-4-5-10(7-11)14-9/h9-11,14H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | RLLBOMUWVKKGTA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid (CID 79619645) is 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid is CN(CC(C)(C)C(=O)O)C1CC2CCC(C1)N2.
What is the InChIKey of 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid?
The InChIKey is RLLBOMUWVKKGTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-13(2,12(16)17)8-15(3)11-6-9-4-5-10(7-11)14-9/h9-11,14H,4-8H2,1-3H3,(H,16,17).
What are the key properties of 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid?
3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid has a molecular weight of 240.35 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[8-azabicyclo[3.2.1]octan-3-yl(methyl)amino]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79619645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).