C14H24ClN3O2S — CID 79619921
3-[[4-(1-chloroethyl)-3,5-dimethylpyrazol-1-yl]methyl]-1-methylsulfonylpiperidine (PubChem CID 79619921) has the molecular formula C14H24ClN3O2S and a molecular weight of 333.89 g/mol. Its IUPAC name is 3-[[4-(1-chloroethyl)-3,5-dimethylpyrazol-1-yl]methyl]-1-methylsulfonylpiperidine.
| Compound Name | 3-[[4-(1-chloroethyl)-3,5-dimethylpyrazol-1-yl]methyl]-1-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 79619921 |
| Molecular Formula | C14H24ClN3O2S |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-[[4-(1-chloroethyl)-3,5-dimethylpyrazol-1-yl]methyl]-1-methylsulfonylpiperidine |
| SMILES | Cc1nn(CC2CCCN(S(C)(=O)=O)C2)c(C)c1C(C)Cl |
| InChI | InChI=1S/C14H24ClN3O2S/c1-10(15)14-11(2)16-18(12(14)3)9-13-6-5-7-17(8-13)21(4,19)20/h10,13H,5-9H2,1-4H3 |
| InChIKey | JQAJHPUOFZOTNL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|