About (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate
(3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate (PubChem CID 79620796) has the molecular formula C12H18N2O4
and a molecular weight of 254.29 g/mol. Its IUPAC name is (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate |
| PubChem CID | 79620796 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)C(C)(C)COC(=O)c1cc(N)cn1C |
| InChI | InChI=1S/C12H18N2O4/c1-12(2,11(16)17-4)7-18-10(15)9-5-8(13)6-14(9)3/h5-6H,7,13H2,1-4H3 |
| InChIKey | HWIKFAWUQUWWDN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate?
The IUPAC name of (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate (CID 79620796) is (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate.
What is the SMILES notation for (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate?
The canonical SMILES for (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate is COC(=O)C(C)(C)COC(=O)c1cc(N)cn1C.
What is the InChIKey of (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate?
The InChIKey is HWIKFAWUQUWWDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4/c1-12(2,11(16)17-4)7-18-10(15)9-5-8(13)6-14(9)3/h5-6H,7,13H2,1-4H3.
What are the key properties of (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate?
(3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate has a molecular weight of 254.29 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-2,2-dimethyl-3-oxopropyl) 4-amino-1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 79620796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).