About 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine
3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine (PubChem CID 79621154) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine |
| PubChem CID | 79621154 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine |
| SMILES | C=CCCOCC(C)(C)CNC(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-7-8-9-15-11-13(5,6)10-14-12(2,3)4/h7,14H,1,8-11H2,2-6H3 |
| InChIKey | KBZJKDYGXRNVCQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine?
The IUPAC name of 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine (CID 79621154) is 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine.
What is the SMILES notation for 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine?
The canonical SMILES for 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine is C=CCCOCC(C)(C)CNC(C)(C)C.
What is the InChIKey of 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine?
The InChIKey is KBZJKDYGXRNVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-7-8-9-15-11-13(5,6)10-14-12(2,3)4/h7,14H,1,8-11H2,2-6H3.
What are the key properties of 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine?
3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine has a molecular weight of 213.36 g/mol, XLogP of 2.99, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-enoxy-N-tert-butyl-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 79621154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).