About methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate
methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate (PubChem CID 79621228) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate.
Analyze methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate (CID 79621228) is methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate is COC(=O)C(C)(C)CN1CCCC(C)C1C.
What is the InChIKey of methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate?
The InChIKey is OGOVZSBOHOTNTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-10-7-6-8-14(11(10)2)9-13(3,4)12(15)16-5/h10-11H,6-9H2,1-5H3.
What are the key properties of methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate?
methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate has a molecular weight of 227.35 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,3-dimethylpiperidin-1-yl)-2,2-dimethylpropanoate is sourced from PubChem (CID 79621228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).