C10H17N3O2 — CID 79621560
3-(2-cyanopiperazin-1-yl)-2,2-dimethylpropanoic acid (PubChem CID 79621560) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(2-cyanopiperazin-1-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(2-cyanopiperazin-1-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79621560 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-(2-cyanopiperazin-1-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CN1CCNCC1C#N)C(=O)O |
| InChI | InChI=1S/C10H17N3O2/c1-10(2,9(14)15)7-13-4-3-12-6-8(13)5-11/h8,12H,3-4,6-7H2,1-2H3,(H,14,15) |
| InChIKey | SZBWUMMIFQTNFK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |