About 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid
3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid (PubChem CID 79621771) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid |
| PubChem CID | 79621771 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cn1ccc(C(=O)C2CC2)c1)C(=O)O |
| InChI | InChI=1S/C13H17NO3/c1-13(2,12(16)17)8-14-6-5-10(7-14)11(15)9-3-4-9/h5-7,9H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | PQXQRIAMDBZJMO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid (CID 79621771) is 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid is CC(C)(Cn1ccc(C(=O)C2CC2)c1)C(=O)O.
What is the InChIKey of 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid?
The InChIKey is PQXQRIAMDBZJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-13(2,12(16)17)8-14-6-5-10(7-14)11(15)9-3-4-9/h5-7,9H,3-4,8H2,1-2H3,(H,16,17).
What are the key properties of 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid?
3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid has a molecular weight of 235.28 g/mol, XLogP of 2.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(cyclopropanecarbonyl)pyrrol-1-yl]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79621771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).