About methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate
methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate (PubChem CID 79622181) has the molecular formula C12H14ClFO3
and a molecular weight of 260.69 g/mol. Its IUPAC name is methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate.
Analyze methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate (CID 79622181) is methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate is COC(=O)C(C)(C)COc1ccc(F)cc1Cl.
What is the InChIKey of methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate?
The InChIKey is USNGZOLUEXRVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClFO3/c1-12(2,11(15)16-3)7-17-10-5-4-8(14)6-9(10)13/h4-6H,7H2,1-3H3.
What are the key properties of methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate?
methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate has a molecular weight of 260.69 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-chloro-4-fluorophenoxy)-2,2-dimethylpropanoate is sourced from PubChem (CID 79622181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).