2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid

C12H15NO5 — CID 79622273

IUPAC2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid
SMILESCc1c(OCC(C)(C)C(=O)O)cccc1[N+](=O)[O-]
InChIInChI=1S/C12H15NO5/c1-8-9(13(16)17)5-4-6-10(8)18-7-12(2,3)11(14)15/h4-6H,7H2,1-3H3,(H,14,15)
InChIKeyZQLFLKVBSDCAAV-UHFFFAOYSA-N
MW253.25 g/mol
LogP2.39
Rot. Bonds5

About 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid

2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid (PubChem CID 79622273) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid.

Molecular Properties

Compound Name2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid
PubChem CID79622273
Molecular FormulaC12H15NO5
Molecular Weight253.25 g/mol
Exact Mass253.10
IUPAC Name2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid
SMILESCc1c(OCC(C)(C)C(=O)O)cccc1[N+](=O)[O-]
InChIInChI=1S/C12H15NO5/c1-8-9(13(16)17)5-4-6-10(8)18-7-12(2,3)11(14)15/h4-6H,7H2,1-3H3,(H,14,15)
InChIKeyZQLFLKVBSDCAAV-UHFFFAOYSA-N
XLogP2.39
TPSA89.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.25
LogP ≤ 52.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid?
The IUPAC name of 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid (CID 79622273) is 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid.
What is the SMILES notation for 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid?
The canonical SMILES for 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid is Cc1c(OCC(C)(C)C(=O)O)cccc1[N+](=O)[O-].
What is the InChIKey of 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid?
The InChIKey is ZQLFLKVBSDCAAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO5/c1-8-9(13(16)17)5-4-6-10(8)18-7-12(2,3)11(14)15/h4-6H,7H2,1-3H3,(H,14,15).
What are the key properties of 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid?
2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid has a molecular weight of 253.25 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(2-methyl-3-nitrophenoxy)propanoic acid is sourced from PubChem (CID 79622273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).