C11H11Cl2N3O2S — CID 79623363
3-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2,2-dimethylpropanoic acid (PubChem CID 79623363) has the molecular formula C11H11Cl2N3O2S and a molecular weight of 320.20 g/mol. Its IUPAC name is 3-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79623363 |
| Molecular Formula | C11H11Cl2N3O2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 3-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNc1c(Cl)cc(Cl)c2c1N=S=N2)C(=O)O |
| InChI | InChI=1S/C11H11Cl2N3O2S/c1-11(2,10(17)18)4-14-7-5(12)3-6(13)8-9(7)16-19-15-8/h3,14H,4H2,1-2H3,(H,17,18) |
| InChIKey | DJPVMAYRIQAVLQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |