C14H25N3O2 — CID 79623377
3-[4-(1-cyanobutyl)piperazin-1-yl]-2,2-dimethylpropanoic acid (PubChem CID 79623377) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-[4-(1-cyanobutyl)piperazin-1-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-(1-cyanobutyl)piperazin-1-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79623377 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 3-[4-(1-cyanobutyl)piperazin-1-yl]-2,2-dimethylpropanoic acid |
| SMILES | CCCC(C#N)N1CCN(CC(C)(C)C(=O)O)CC1 |
| InChI | InChI=1S/C14H25N3O2/c1-4-5-12(10-15)17-8-6-16(7-9-17)11-14(2,3)13(18)19/h12H,4-9,11H2,1-3H3,(H,18,19) |
| InChIKey | TZRKWEIMGRCNFA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |