C17H21NO2 — CID 79623968
methyl 2,2-dimethyl-3-(naphthalen-1-ylmethylamino)propanoate (PubChem CID 79623968) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-(naphthalen-1-ylmethylamino)propanoate.
| Compound Name | methyl 2,2-dimethyl-3-(naphthalen-1-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 79623968 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | methyl 2,2-dimethyl-3-(naphthalen-1-ylmethylamino)propanoate |
| SMILES | COC(=O)C(C)(C)CNCc1cccc2ccccc12 |
| InChI | InChI=1S/C17H21NO2/c1-17(2,16(19)20-3)12-18-11-14-9-6-8-13-7-4-5-10-15(13)14/h4-10,18H,11-12H2,1-3H3 |
| InChIKey | VQYKPKRNRXGSDX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |