C13H12Cl2O2 — CID 79625699
3-(2,6-dichlorobenzoyl)cyclohexan-1-one (PubChem CID 79625699) has the molecular formula C13H12Cl2O2 and a molecular weight of 271.14 g/mol. Its IUPAC name is 3-(2,6-dichlorobenzoyl)cyclohexan-1-one.
| Compound Name | 3-(2,6-dichlorobenzoyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 79625699 |
| Molecular Formula | C13H12Cl2O2 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 3-(2,6-dichlorobenzoyl)cyclohexan-1-one |
| SMILES | O=C1CCCC(C(=O)c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C13H12Cl2O2/c14-10-5-2-6-11(15)12(10)13(17)8-3-1-4-9(16)7-8/h2,5-6,8H,1,3-4,7H2 |
| InChIKey | FBRUFZANGDZJLC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |