C17H15N3OS2 — CID 796265
N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]benzamide (PubChem CID 796265) has the molecular formula C17H15N3OS2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]benzamide.
| Compound Name | N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 796265 |
| Molecular Formula | C17H15N3OS2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]benzamide |
| SMILES | N#Cc1c(NC(=S)NC(=O)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C17H15N3OS2/c18-10-13-12-8-4-5-9-14(12)23-16(13)20-17(22)19-15(21)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-9H2,(H2,19,20,21,22) |
| InChIKey | IBQJWZNNSYUOII-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|