C11H21F3N4O — CID 79627170
2,2-dimethyl-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanehydrazide (PubChem CID 79627170) has the molecular formula C11H21F3N4O and a molecular weight of 282.31 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanehydrazide.
| Compound Name | 2,2-dimethyl-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 79627170 |
| Molecular Formula | C11H21F3N4O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2,2-dimethyl-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanehydrazide |
| SMILES | CC(C)(CN1CCN(CC(F)(F)F)CC1)C(=O)NN |
| InChI | InChI=1S/C11H21F3N4O/c1-10(2,9(19)16-15)7-17-3-5-18(6-4-17)8-11(12,13)14/h3-8,15H2,1-2H3,(H,16,19) |
| InChIKey | PVQKPPMCPABFMH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|