About N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine
N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine (PubChem CID 79628640) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine |
| PubChem CID | 79628640 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine |
| SMILES | CC(C)(CNC1CC1)COCC1CCOC1 |
| InChI | InChI=1S/C13H25NO2/c1-13(2,9-14-12-3-4-12)10-16-8-11-5-6-15-7-11/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | SOLZSNXDCPCNRR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine?
The IUPAC name of N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine (CID 79628640) is N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine.
What is the SMILES notation for N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine?
The canonical SMILES for N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine is CC(C)(CNC1CC1)COCC1CCOC1.
What is the InChIKey of N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine?
The InChIKey is SOLZSNXDCPCNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-13(2,9-14-12-3-4-12)10-16-8-11-5-6-15-7-11/h11-12,14H,3-10H2,1-2H3.
What are the key properties of N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine?
N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine has a molecular weight of 227.35 g/mol, XLogP of 1.82, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-dimethyl-3-(oxolan-3-ylmethoxy)propyl]cyclopropanamine is sourced from PubChem (CID 79628640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).