C11H14ClNO2S — CID 79629062
3-(2-amino-5-chlorophenyl)sulfanyl-2,2-dimethylpropanoic acid (PubChem CID 79629062) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is 3-(2-amino-5-chlorophenyl)sulfanyl-2,2-dimethylpropanoic acid.
| Compound Name | 3-(2-amino-5-chlorophenyl)sulfanyl-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79629062 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 3-(2-amino-5-chlorophenyl)sulfanyl-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CSc1cc(Cl)ccc1N)C(=O)O |
| InChI | InChI=1S/C11H14ClNO2S/c1-11(2,10(14)15)6-16-9-5-7(12)3-4-8(9)13/h3-5H,6,13H2,1-2H3,(H,14,15) |
| InChIKey | FEVKYHVVPDEWNN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|