C9H12N2O4 — CID 79629259
3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoic acid (PubChem CID 79629259) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79629259 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cn1[nH]c(=O)ccc1=O)C(=O)O |
| InChI | InChI=1S/C9H12N2O4/c1-9(2,8(14)15)5-11-7(13)4-3-6(12)10-11/h3-4H,5H2,1-2H3,(H,10,12)(H,14,15) |
| InChIKey | QSTGMDVPPPRMMN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |