About methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate
methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate (PubChem CID 79629356) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate.
Analyze methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate (CID 79629356) is methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate is COC(=O)C(C)(C)Cn1[nH]c(=O)ccc1=O.
What is the InChIKey of methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate?
The InChIKey is ITIMZAQWKTZKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-10(2,9(15)16-3)6-12-8(14)5-4-7(13)11-12/h4-5H,6H2,1-3H3,(H,11,13).
What are the key properties of methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate?
methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate has a molecular weight of 226.23 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylpropanoate is sourced from PubChem (CID 79629356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).