C13H19NO2S — CID 79629545
methyl 3-(4-amino-3-methylphenyl)sulfanyl-2,2-dimethylpropanoate (PubChem CID 79629545) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is methyl 3-(4-amino-3-methylphenyl)sulfanyl-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(4-amino-3-methylphenyl)sulfanyl-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 79629545 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl 3-(4-amino-3-methylphenyl)sulfanyl-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)CSc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C13H19NO2S/c1-9-7-10(5-6-11(9)14)17-8-13(2,3)12(15)16-4/h5-7H,8,14H2,1-4H3 |
| InChIKey | NKOQEDKFMAMZMT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|