C13H13F2N3O3 — CID 79629837
3-(5,7-difluoro-2,3-dioxoindol-1-yl)-2,2-dimethylpropanehydrazide (PubChem CID 79629837) has the molecular formula C13H13F2N3O3 and a molecular weight of 297.26 g/mol. Its IUPAC name is 3-(5,7-difluoro-2,3-dioxoindol-1-yl)-2,2-dimethylpropanehydrazide.
| Compound Name | 3-(5,7-difluoro-2,3-dioxoindol-1-yl)-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 79629837 |
| Molecular Formula | C13H13F2N3O3 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-(5,7-difluoro-2,3-dioxoindol-1-yl)-2,2-dimethylpropanehydrazide |
| SMILES | CC(C)(CN1C(=O)C(=O)c2cc(F)cc(F)c21)C(=O)NN |
| InChI | InChI=1S/C13H13F2N3O3/c1-13(2,12(21)17-16)5-18-9-7(10(19)11(18)20)3-6(14)4-8(9)15/h3-4H,5,16H2,1-2H3,(H,17,21) |
| InChIKey | BLGNCVVBZCZLEE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|