About methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate
methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 79630149) has the molecular formula C9H15NO3S
and a molecular weight of 217.29 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
Molecular Properties
| Compound Name | methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| PubChem CID | 79630149 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | COC(=O)C(C)(C)CN1CCSC1=O |
| InChI | InChI=1S/C9H15NO3S/c1-9(2,7(11)13-3)6-10-4-5-14-8(10)12/h4-6H2,1-3H3 |
| InChIKey | JTAIKCHTLCZZND-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate?
The IUPAC name of methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (CID 79630149) is methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
What is the SMILES notation for methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate?
The canonical SMILES for methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate is COC(=O)C(C)(C)CN1CCSC1=O.
What is the InChIKey of methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate?
The InChIKey is JTAIKCHTLCZZND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3S/c1-9(2,7(11)13-3)6-10-4-5-14-8(10)12/h4-6H2,1-3H3.
What are the key properties of methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate?
methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate has a molecular weight of 217.29 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-3-(2-oxo-1,3-thiazolidin-3-yl)propanoate is sourced from PubChem (CID 79630149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).