C15H17NO4 — CID 79630344
3-(4,7-dimethyl-2,3-dioxoindol-1-yl)-2,2-dimethylpropanoic acid (PubChem CID 79630344) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-(4,7-dimethyl-2,3-dioxoindol-1-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(4,7-dimethyl-2,3-dioxoindol-1-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79630344 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-(4,7-dimethyl-2,3-dioxoindol-1-yl)-2,2-dimethylpropanoic acid |
| SMILES | Cc1ccc(C)c2c1C(=O)C(=O)N2CC(C)(C)C(=O)O |
| InChI | InChI=1S/C15H17NO4/c1-8-5-6-9(2)11-10(8)12(17)13(18)16(11)7-15(3,4)14(19)20/h5-6H,7H2,1-4H3,(H,19,20) |
| InChIKey | HHISTAYGJZCFBM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|