C10H15F3N4O3 — CID 79630523
2,2-dimethyl-3-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]propanehydrazide (PubChem CID 79630523) has the molecular formula C10H15F3N4O3 and a molecular weight of 296.25 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]propanehydrazide.
| Compound Name | 2,2-dimethyl-3-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 79630523 |
| Molecular Formula | C10H15F3N4O3 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2,2-dimethyl-3-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]propanehydrazide |
| SMILES | CC(C)(CN1C(=O)NC(C)(C(F)(F)F)C1=O)C(=O)NN |
| InChI | InChI=1S/C10H15F3N4O3/c1-8(2,5(18)16-14)4-17-6(19)9(3,10(11,12)13)15-7(17)20/h4,14H2,1-3H3,(H,15,20)(H,16,18) |
| InChIKey | QTFRBTYXVAVFAJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|