About 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide
3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide (PubChem CID 79630790) has the molecular formula C11H20N4O3
and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide.
Molecular Properties
| Compound Name | 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide |
| PubChem CID | 79630790 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide |
| SMILES | CCN1CCN(CC(C)(C)C(=O)NN)C(=O)C1=O |
| InChI | InChI=1S/C11H20N4O3/c1-4-14-5-6-15(9(17)8(14)16)7-11(2,3)10(18)13-12/h4-7,12H2,1-3H3,(H,13,18) |
| InChIKey | KYHUJGBJMBELIV-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide?
The IUPAC name of 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide (CID 79630790) is 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide.
What is the SMILES notation for 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide?
The canonical SMILES for 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide is CCN1CCN(CC(C)(C)C(=O)NN)C(=O)C1=O.
What is the InChIKey of 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide?
The InChIKey is KYHUJGBJMBELIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O3/c1-4-14-5-6-15(9(17)8(14)16)7-11(2,3)10(18)13-12/h4-7,12H2,1-3H3,(H,13,18).
What are the key properties of 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide?
3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide has a molecular weight of 256.31 g/mol, XLogP of -1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethyl-2,3-dioxopiperazin-1-yl)-2,2-dimethylpropanehydrazide is sourced from PubChem (CID 79630790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).