About 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole
5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole (PubChem CID 79631045) has the molecular formula C16H14BrFN2
and a molecular weight of 333.20 g/mol. Its IUPAC name is 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole |
| PubChem CID | 79631045 |
| Molecular Formula | C16H14BrFN2 |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole |
| SMILES | Cc1cc(C)c(-c2nc3cc(Br)c(F)cc3[nH]2)c(C)c1 |
| InChI | InChI=1S/C16H14BrFN2/c1-8-4-9(2)15(10(3)5-8)16-19-13-6-11(17)12(18)7-14(13)20-16/h4-7H,1-3H3,(H,19,20) |
| InChIKey | ITLAEAFZYVMOSR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole?
The IUPAC name of 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole (CID 79631045) is 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole.
What is the SMILES notation for 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole?
The canonical SMILES for 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole is Cc1cc(C)c(-c2nc3cc(Br)c(F)cc3[nH]2)c(C)c1.
What is the InChIKey of 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole?
The InChIKey is ITLAEAFZYVMOSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrFN2/c1-8-4-9(2)15(10(3)5-8)16-19-13-6-11(17)12(18)7-14(13)20-16/h4-7H,1-3H3,(H,19,20).
What are the key properties of 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole?
5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole has a molecular weight of 333.20 g/mol, XLogP of 5.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-fluoro-2-(2,4,6-trimethylphenyl)-1H-benzimidazole is sourced from PubChem (CID 79631045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).