C13H13Cl2N3 — CID 79631877
2,5-dichloro-N-[2-(3-methylphenyl)ethyl]pyrimidin-4-amine (PubChem CID 79631877) has the molecular formula C13H13Cl2N3 and a molecular weight of 282.17 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(3-methylphenyl)ethyl]pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-[2-(3-methylphenyl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 79631877 |
| Molecular Formula | C13H13Cl2N3 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2,5-dichloro-N-[2-(3-methylphenyl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1cccc(CCNc2nc(Cl)ncc2Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N3/c1-9-3-2-4-10(7-9)5-6-16-12-11(14)8-17-13(15)18-12/h2-4,7-8H,5-6H2,1H3,(H,16,17,18) |
| InChIKey | HACQZQAQKNWISV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |