C7H6Cl2F3N3 — CID 79632100
2,5-dichloro-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine (PubChem CID 79632100) has the molecular formula C7H6Cl2F3N3 and a molecular weight of 260.05 g/mol. Its IUPAC name is 2,5-dichloro-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79632100 |
| Molecular Formula | C7H6Cl2F3N3 |
| Molecular Weight | 260.05 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 2,5-dichloro-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)CCNc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C7H6Cl2F3N3/c8-4-3-14-6(9)15-5(4)13-2-1-7(10,11)12/h3H,1-2H2,(H,13,14,15) |
| InChIKey | AGYDARFBIYWRIM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.05 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |