About 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine
2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine (PubChem CID 79632122) has the molecular formula C10H15Cl2N3S
and a molecular weight of 280.22 g/mol. Its IUPAC name is 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine |
| PubChem CID | 79632122 |
| Molecular Formula | C10H15Cl2N3S |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine |
| SMILES | CCN(CC)CCSc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C10H15Cl2N3S/c1-3-15(4-2)5-6-16-9-8(11)7-13-10(12)14-9/h7H,3-6H2,1-2H3 |
| InChIKey | POXLYXMJXYYWFX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine?
The IUPAC name of 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine (CID 79632122) is 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine.
What is the SMILES notation for 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine?
The canonical SMILES for 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine is CCN(CC)CCSc1nc(Cl)ncc1Cl.
What is the InChIKey of 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine?
The InChIKey is POXLYXMJXYYWFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Cl2N3S/c1-3-15(4-2)5-6-16-9-8(11)7-13-10(12)14-9/h7H,3-6H2,1-2H3.
What are the key properties of 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine?
2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine has a molecular weight of 280.22 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dichloropyrimidin-4-yl)sulfanyl-N,N-diethylethanamine is sourced from PubChem (CID 79632122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).