About 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane
1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane (PubChem CID 79632687) has the molecular formula C10H14Cl2N4
and a molecular weight of 261.16 g/mol. Its IUPAC name is 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane |
| PubChem CID | 79632687 |
| Molecular Formula | C10H14Cl2N4 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(c2nc(Cl)ncc2Cl)CC1 |
| InChI | InChI=1S/C10H14Cl2N4/c1-15-3-2-4-16(6-5-15)9-8(11)7-13-10(12)14-9/h7H,2-6H2,1H3 |
| InChIKey | LOQPARJHYOZZFP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane?
The IUPAC name of 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane (CID 79632687) is 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane.
What is the SMILES notation for 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane?
The canonical SMILES for 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane is CN1CCCN(c2nc(Cl)ncc2Cl)CC1.
What is the InChIKey of 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane?
The InChIKey is LOQPARJHYOZZFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl2N4/c1-15-3-2-4-16(6-5-15)9-8(11)7-13-10(12)14-9/h7H,2-6H2,1H3.
What are the key properties of 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane?
1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane has a molecular weight of 261.16 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dichloropyrimidin-4-yl)-4-methyl-1,4-diazepane is sourced from PubChem (CID 79632687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).