About 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane
1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane (PubChem CID 79633042) has the molecular formula C12H17Cl2N3
and a molecular weight of 274.19 g/mol. Its IUPAC name is 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane.
Molecular Properties
| Compound Name | 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane |
| PubChem CID | 79633042 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane |
| SMILES | CC1(C)CCCN(c2nc(Cl)ncc2Cl)CC1 |
| InChI | InChI=1S/C12H17Cl2N3/c1-12(2)4-3-6-17(7-5-12)10-9(13)8-15-11(14)16-10/h8H,3-7H2,1-2H3 |
| InChIKey | YXNPUXLZVYNLRC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane?
The IUPAC name of 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane (CID 79633042) is 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane.
What is the SMILES notation for 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane?
The canonical SMILES for 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane is CC1(C)CCCN(c2nc(Cl)ncc2Cl)CC1.
What is the InChIKey of 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane?
The InChIKey is YXNPUXLZVYNLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl2N3/c1-12(2)4-3-6-17(7-5-12)10-9(13)8-15-11(14)16-10/h8H,3-7H2,1-2H3.
What are the key properties of 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane?
1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane has a molecular weight of 274.19 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dichloropyrimidin-4-yl)-4,4-dimethylazepane is sourced from PubChem (CID 79633042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).