About 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine
4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine (PubChem CID 79633246) has the molecular formula C7H3BrCl2N4
and a molecular weight of 293.94 g/mol. Its IUPAC name is 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine.
Molecular Properties
| Compound Name | 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine |
| PubChem CID | 79633246 |
| Molecular Formula | C7H3BrCl2N4 |
| Molecular Weight | 293.94 g/mol |
| Exact Mass | 291.89 |
| IUPAC Name | 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine |
| SMILES | Clc1ncc(Cl)c(-n2cc(Br)cn2)n1 |
| InChI | InChI=1S/C7H3BrCl2N4/c8-4-1-12-14(3-4)6-5(9)2-11-7(10)13-6/h1-3H |
| InChIKey | XHVCOOBAKUDESH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine?
The IUPAC name of 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine (CID 79633246) is 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine.
What is the SMILES notation for 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine?
The canonical SMILES for 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine is Clc1ncc(Cl)c(-n2cc(Br)cn2)n1.
What is the InChIKey of 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine?
The InChIKey is XHVCOOBAKUDESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrCl2N4/c8-4-1-12-14(3-4)6-5(9)2-11-7(10)13-6/h1-3H.
What are the key properties of 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine?
4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine has a molecular weight of 293.94 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromopyrazol-1-yl)-2,5-dichloropyrimidine is sourced from PubChem (CID 79633246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).