C17H30N2O2 — CID 79633832
3-[cyclopropyl(cyclopropylmethyl)amino]-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid (PubChem CID 79633832) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-[cyclopropyl(cyclopropylmethyl)amino]-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3-[cyclopropyl(cyclopropylmethyl)amino]-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79633832 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 3-[cyclopropyl(cyclopropylmethyl)amino]-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)NC1(C(=O)O)CCCC(N(CC2CC2)C2CC2)C1 |
| InChI | InChI=1S/C17H30N2O2/c1-12(2)18-17(16(20)21)9-3-4-15(10-17)19(14-7-8-14)11-13-5-6-13/h12-15,18H,3-11H2,1-2H3,(H,20,21) |
| InChIKey | KYCLLAPSMNDBOV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |