About ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate
ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate (PubChem CID 79634930) has the molecular formula C14H24F3NO3
and a molecular weight of 311.34 g/mol. Its IUPAC name is ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate |
| PubChem CID | 79634930 |
| Molecular Formula | C14H24F3NO3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(C)C)CCCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H24F3NO3/c1-4-20-12(19)13(18-10(2)3)7-5-6-11(8-13)21-9-14(15,16)17/h10-11,18H,4-9H2,1-3H3 |
| InChIKey | WIIWBAFJQQXJSO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate?
The IUPAC name of ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate (CID 79634930) is ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate is CCOC(=O)C1(NC(C)C)CCCC(OCC(F)(F)F)C1.
What is the InChIKey of ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate?
The InChIKey is WIIWBAFJQQXJSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F3NO3/c1-4-20-12(19)13(18-10(2)3)7-5-6-11(8-13)21-9-14(15,16)17/h10-11,18H,4-9H2,1-3H3.
What are the key properties of ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate?
ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate has a molecular weight of 311.34 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylate is sourced from PubChem (CID 79634930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).