About methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate
methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate (PubChem CID 79635854) has the molecular formula C11H17N3O2S2
and a molecular weight of 287.41 g/mol. Its IUPAC name is methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate |
| PubChem CID | 79635854 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate |
| SMILES | CNC1(C(=O)OC)CCCC(Sc2nncs2)C1 |
| InChI | InChI=1S/C11H17N3O2S2/c1-12-11(9(15)16-2)5-3-4-8(6-11)18-10-14-13-7-17-10/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | SCVJJPLRRBRFMV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate?
The IUPAC name of methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate (CID 79635854) is methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate is CNC1(C(=O)OC)CCCC(Sc2nncs2)C1.
What is the InChIKey of methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate?
The InChIKey is SCVJJPLRRBRFMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2S2/c1-12-11(9(15)16-2)5-3-4-8(6-11)18-10-14-13-7-17-10/h7-8,12H,3-6H2,1-2H3.
What are the key properties of methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate?
methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate has a molecular weight of 287.41 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 79635854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).