C16H33N3O — CID 79636769
3-[methyl(pentan-3-yl)amino]-1-(propan-2-ylamino)cyclohexane-1-carboxamide (PubChem CID 79636769) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is 3-[methyl(pentan-3-yl)amino]-1-(propan-2-ylamino)cyclohexane-1-carboxamide.
| Compound Name | 3-[methyl(pentan-3-yl)amino]-1-(propan-2-ylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79636769 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 3-[methyl(pentan-3-yl)amino]-1-(propan-2-ylamino)cyclohexane-1-carboxamide |
| SMILES | CCC(CC)N(C)C1CCCC(NC(C)C)(C(N)=O)C1 |
| InChI | InChI=1S/C16H33N3O/c1-6-13(7-2)19(5)14-9-8-10-16(11-14,15(17)20)18-12(3)4/h12-14,18H,6-11H2,1-5H3,(H2,17,20) |
| InChIKey | NMMAFTQUNIZWAU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |