About 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide
1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide (PubChem CID 79637457) has the molecular formula C12H19BrN4O
and a molecular weight of 315.22 g/mol. Its IUPAC name is 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide |
| PubChem CID | 79637457 |
| Molecular Formula | C12H19BrN4O |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide |
| SMILES | Cc1nn(C2CCCC(N)(C(N)=O)C2)c(C)c1Br |
| InChI | InChI=1S/C12H19BrN4O/c1-7-10(13)8(2)17(16-7)9-4-3-5-12(15,6-9)11(14)18/h9H,3-6,15H2,1-2H3,(H2,14,18) |
| InChIKey | RJDAUYXLFGPGBM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide?
The IUPAC name of 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide (CID 79637457) is 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide.
What is the SMILES notation for 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide?
The canonical SMILES for 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide is Cc1nn(C2CCCC(N)(C(N)=O)C2)c(C)c1Br.
What is the InChIKey of 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide?
The InChIKey is RJDAUYXLFGPGBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BrN4O/c1-7-10(13)8(2)17(16-7)9-4-3-5-12(15,6-9)11(14)18/h9H,3-6,15H2,1-2H3,(H2,14,18).
What are the key properties of 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide?
1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide has a molecular weight of 315.22 g/mol, XLogP of 1.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(4-bromo-3,5-dimethylpyrazol-1-yl)cyclohexane-1-carboxamide is sourced from PubChem (CID 79637457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).