C16H31NO3 — CID 79638073
3-(2-ethylhexoxy)-1-(methylamino)cyclohexane-1-carboxylic acid (PubChem CID 79638073) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 3-(2-ethylhexoxy)-1-(methylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(2-ethylhexoxy)-1-(methylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79638073 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 3-(2-ethylhexoxy)-1-(methylamino)cyclohexane-1-carboxylic acid |
| SMILES | CCCCC(CC)COC1CCCC(NC)(C(=O)O)C1 |
| InChI | InChI=1S/C16H31NO3/c1-4-6-8-13(5-2)12-20-14-9-7-10-16(11-14,17-3)15(18)19/h13-14,17H,4-12H2,1-3H3,(H,18,19) |
| InChIKey | UAYTYLBOCMUFJV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |