C18H29NO2 — CID 79638648
[3-(2,5-dimethylphenoxy)-1-(propylamino)cyclohexyl]methanol (PubChem CID 79638648) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is [3-(2,5-dimethylphenoxy)-1-(propylamino)cyclohexyl]methanol.
| Compound Name | [3-(2,5-dimethylphenoxy)-1-(propylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 79638648 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | [3-(2,5-dimethylphenoxy)-1-(propylamino)cyclohexyl]methanol |
| SMILES | CCCNC1(CO)CCCC(Oc2cc(C)ccc2C)C1 |
| InChI | InChI=1S/C18H29NO2/c1-4-10-19-18(13-20)9-5-6-16(12-18)21-17-11-14(2)7-8-15(17)3/h7-8,11,16,19-20H,4-6,9-10,12-13H2,1-3H3 |
| InChIKey | QSHGQTKNPFCWBV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |