C15H17F3N2O — CID 79638685
1-(ethylamino)-3-[2-(trifluoromethyl)phenoxy]cyclopentane-1-carbonitrile (PubChem CID 79638685) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is 1-(ethylamino)-3-[2-(trifluoromethyl)phenoxy]cyclopentane-1-carbonitrile.
| Compound Name | 1-(ethylamino)-3-[2-(trifluoromethyl)phenoxy]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79638685 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-(ethylamino)-3-[2-(trifluoromethyl)phenoxy]cyclopentane-1-carbonitrile |
| SMILES | CCNC1(C#N)CCC(Oc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C15H17F3N2O/c1-2-20-14(10-19)8-7-11(9-14)21-13-6-4-3-5-12(13)15(16,17)18/h3-6,11,20H,2,7-9H2,1H3 |
| InChIKey | PYPVLTAUCQXMRE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |