C10H18N2O — CID 79639311
3-methoxy-1-(propan-2-ylamino)cyclopentane-1-carbonitrile (PubChem CID 79639311) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-methoxy-1-(propan-2-ylamino)cyclopentane-1-carbonitrile.
| Compound Name | 3-methoxy-1-(propan-2-ylamino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79639311 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-methoxy-1-(propan-2-ylamino)cyclopentane-1-carbonitrile |
| SMILES | COC1CCC(C#N)(NC(C)C)C1 |
| InChI | InChI=1S/C10H18N2O/c1-8(2)12-10(7-11)5-4-9(6-10)13-3/h8-9,12H,4-6H2,1-3H3 |
| InChIKey | PMYITWMFUBQIKG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |