C16H22FNOS — CID 79640361
[1-(cyclopropylamino)-3-(4-fluorophenyl)sulfanylcyclohexyl]methanol (PubChem CID 79640361) has the molecular formula C16H22FNOS and a molecular weight of 295.42 g/mol. Its IUPAC name is [1-(cyclopropylamino)-3-(4-fluorophenyl)sulfanylcyclohexyl]methanol.
| Compound Name | [1-(cyclopropylamino)-3-(4-fluorophenyl)sulfanylcyclohexyl]methanol |
|---|---|
| PubChem CID | 79640361 |
| Molecular Formula | C16H22FNOS |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [1-(cyclopropylamino)-3-(4-fluorophenyl)sulfanylcyclohexyl]methanol |
| SMILES | OCC1(NC2CC2)CCCC(Sc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H22FNOS/c17-12-3-7-14(8-4-12)20-15-2-1-9-16(10-15,11-19)18-13-5-6-13/h3-4,7-8,13,15,18-19H,1-2,5-6,9-11H2 |
| InChIKey | YMVCONDZLVSQLZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |