C15H32N2O2 — CID 79640869
[3-[ethyl(2-methoxyethyl)amino]-1-(propan-2-ylamino)cyclohexyl]methanol (PubChem CID 79640869) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is [3-[ethyl(2-methoxyethyl)amino]-1-(propan-2-ylamino)cyclohexyl]methanol.
| Compound Name | [3-[ethyl(2-methoxyethyl)amino]-1-(propan-2-ylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 79640869 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | [3-[ethyl(2-methoxyethyl)amino]-1-(propan-2-ylamino)cyclohexyl]methanol |
| SMILES | CCN(CCOC)C1CCCC(CO)(NC(C)C)C1 |
| InChI | InChI=1S/C15H32N2O2/c1-5-17(9-10-19-4)14-7-6-8-15(11-14,12-18)16-13(2)3/h13-14,16,18H,5-12H2,1-4H3 |
| InChIKey | HULZOXMEJHTCPC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |