C16H28N2O2 — CID 79641776
1-amino-3-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 79641776) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-amino-3-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-amino-3-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79641776 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-amino-3-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | CN(CC1CC2CCC1C2)C1CCCC(N)(C(=O)O)C1 |
| InChI | InChI=1S/C16H28N2O2/c1-18(10-13-8-11-4-5-12(13)7-11)14-3-2-6-16(17,9-14)15(19)20/h11-14H,2-10,17H2,1H3,(H,19,20) |
| InChIKey | COLVVDNIYJOMKK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |