About 1-adamantylthiourea
1-adamantylthiourea (PubChem CID 796429) has the molecular formula C11H18N2S
and a molecular weight of 210.35 g/mol. Its IUPAC name is 1-adamantylthiourea.
Molecular Properties
| Compound Name | 1-adamantylthiourea |
| PubChem CID | 796429 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-adamantylthiourea |
| SMILES | NC(=S)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H18N2S/c12-10(14)13-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H3,12,13,14) |
| InChIKey | LRWQENBAFMBIJR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylthiourea?
The IUPAC name of 1-adamantylthiourea (CID 796429) is 1-adamantylthiourea.
What is the SMILES notation for 1-adamantylthiourea?
The canonical SMILES for 1-adamantylthiourea is NC(=S)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantylthiourea?
The InChIKey is LRWQENBAFMBIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2S/c12-10(14)13-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H3,12,13,14).
What are the key properties of 1-adamantylthiourea?
1-adamantylthiourea has a molecular weight of 210.35 g/mol, XLogP of 1.79, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylthiourea is sourced from PubChem (CID 796429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).