About 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine
3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine (PubChem CID 79643445) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine |
| PubChem CID | 79643445 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine |
| SMILES | CCNC1CCC(N(CC)CCOCC)C1 |
| InChI | InChI=1S/C13H28N2O/c1-4-14-12-7-8-13(11-12)15(5-2)9-10-16-6-3/h12-14H,4-11H2,1-3H3 |
| InChIKey | DHKNQJSXMFRCNN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine?
The IUPAC name of 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine (CID 79643445) is 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine.
What is the SMILES notation for 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine?
The canonical SMILES for 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine is CCNC1CCC(N(CC)CCOCC)C1.
What is the InChIKey of 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine?
The InChIKey is DHKNQJSXMFRCNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O/c1-4-14-12-7-8-13(11-12)15(5-2)9-10-16-6-3/h12-14H,4-11H2,1-3H3.
What are the key properties of 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine?
3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine has a molecular weight of 228.38 g/mol, XLogP of 1.88, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2-ethoxyethyl)-1-N,3-N-diethylcyclopentane-1,3-diamine is sourced from PubChem (CID 79643445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).