About 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol
3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol (PubChem CID 79643952) has the molecular formula C10H18F3NO
and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol |
| PubChem CID | 79643952 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol |
| SMILES | CCCN(CC(F)(F)F)C1CCC(O)C1 |
| InChI | InChI=1S/C10H18F3NO/c1-2-5-14(7-10(11,12)13)8-3-4-9(15)6-8/h8-9,15H,2-7H2,1H3 |
| InChIKey | LJRIRTYGZAGVFQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol?
The IUPAC name of 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol (CID 79643952) is 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol.
What is the SMILES notation for 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol?
The canonical SMILES for 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol is CCCN(CC(F)(F)F)C1CCC(O)C1.
What is the InChIKey of 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol?
The InChIKey is LJRIRTYGZAGVFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO/c1-2-5-14(7-10(11,12)13)8-3-4-9(15)6-8/h8-9,15H,2-7H2,1H3.
What are the key properties of 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol?
3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol has a molecular weight of 225.25 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[propyl(2,2,2-trifluoroethyl)amino]cyclopentan-1-ol is sourced from PubChem (CID 79643952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).