About [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol
[3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol (PubChem CID 79644489) has the molecular formula C18H27NOS
and a molecular weight of 305.49 g/mol. Its IUPAC name is [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol |
| PubChem CID | 79644489 |
| Molecular Formula | C18H27NOS |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol |
| SMILES | CCCNC1(CO)CCC(Sc2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C18H27NOS/c1-2-10-19-18(13-20)9-8-17(12-18)21-16-7-6-14-4-3-5-15(14)11-16/h6-7,11,17,19-20H,2-5,8-10,12-13H2,1H3 |
| InChIKey | WDIXBPVFPCBIRJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol?
The IUPAC name of [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol (CID 79644489) is [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol.
What is the SMILES notation for [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol?
The canonical SMILES for [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol is CCCNC1(CO)CCC(Sc2ccc3c(c2)CCC3)C1.
What is the InChIKey of [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol?
The InChIKey is WDIXBPVFPCBIRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NOS/c1-2-10-19-18(13-20)9-8-17(12-18)21-16-7-6-14-4-3-5-15(14)11-16/h6-7,11,17,19-20H,2-5,8-10,12-13H2,1H3.
What are the key properties of [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol?
[3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol has a molecular weight of 305.49 g/mol, XLogP of 3.55, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1-(propylamino)cyclopentyl]methanol is sourced from PubChem (CID 79644489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).