About 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol
2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol (PubChem CID 79644858) has the molecular formula C15H25BrN2O
and a molecular weight of 329.28 g/mol. Its IUPAC name is 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol.
Molecular Properties
| Compound Name | 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol |
| PubChem CID | 79644858 |
| Molecular Formula | C15H25BrN2O |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol |
| SMILES | CCC(c1cc(Br)ccc1O)N(C)CC(C)(C)CN |
| InChI | InChI=1S/C15H25BrN2O/c1-5-13(18(4)10-15(2,3)9-17)12-8-11(16)6-7-14(12)19/h6-8,13,19H,5,9-10,17H2,1-4H3 |
| InChIKey | IUQMOZXGOXPGJF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol?
The IUPAC name of 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol (CID 79644858) is 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol.
What is the SMILES notation for 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol?
The canonical SMILES for 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol is CCC(c1cc(Br)ccc1O)N(C)CC(C)(C)CN.
What is the InChIKey of 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol?
The InChIKey is IUQMOZXGOXPGJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25BrN2O/c1-5-13(18(4)10-15(2,3)9-17)12-8-11(16)6-7-14(12)19/h6-8,13,19H,5,9-10,17H2,1-4H3.
What are the key properties of 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol?
2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol has a molecular weight of 329.28 g/mol, XLogP of 3.52, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(3-amino-2,2-dimethylpropyl)-methylamino]propyl]-4-bromophenol is sourced from PubChem (CID 79644858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).