About 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile
3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile (PubChem CID 79644893) has the molecular formula C14H23N5OS
and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile.
Molecular Properties
| Compound Name | 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile |
| PubChem CID | 79644893 |
| Molecular Formula | C14H23N5OS |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile |
| SMILES | CCCNC1(C#N)CCC(Sc2n[nH]c(=O)n2CCC)C1 |
| InChI | InChI=1S/C14H23N5OS/c1-3-7-16-14(10-15)6-5-11(9-14)21-13-18-17-12(20)19(13)8-4-2/h11,16H,3-9H2,1-2H3,(H,17,20) |
| InChIKey | LDZIGCTWTJHSTD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile?
The IUPAC name of 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile (CID 79644893) is 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile.
What is the SMILES notation for 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile?
The canonical SMILES for 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile is CCCNC1(C#N)CCC(Sc2n[nH]c(=O)n2CCC)C1.
What is the InChIKey of 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile?
The InChIKey is LDZIGCTWTJHSTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5OS/c1-3-7-16-14(10-15)6-5-11(9-14)21-13-18-17-12(20)19(13)8-4-2/h11,16H,3-9H2,1-2H3,(H,17,20).
What are the key properties of 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile?
3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile has a molecular weight of 309.44 g/mol, XLogP of 1.89, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(propylamino)cyclopentane-1-carbonitrile is sourced from PubChem (CID 79644893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).